CAS 898762-50-0

3-(3-chlorophenyl)-1-(4-methylsulfanylphenyl)propan-1-one

Description:

3-(3-Chlorophenyl)-1-(4-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898762-50-0, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chlorophenyl group and a 4-methylsulfanylphenyl group. The presence of the chlorine atom and the methylsulfanyl group contributes to its unique chemical reactivity and potential biological activity. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic rings, while its ketone functionality may participate in various chemical reactions, such as nucleophilic additions or reductions. Additionally, the structural features suggest potential applications in pharmaceuticals or as intermediates in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for a comprehensive understanding of its characteristics.

Formula: C₁₆H₁₅ClOS

InChI: InChI=1/C16H15ClOS/c1-19-15-8-6-13(7-9-15)16(18)10-5-12-3-2-4-14(17)11-12/h2-4,6-9,11H,5,10H2,1H3

SMILES: CSc1ccc(cc1)C(=O)CCc1cccc(c1)Cl