CymitQuimica logo

CAS 898762-57-7

:

Cyclopropyl[2-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone

Description:
Cyclopropyl[2-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone, with the CAS number 898762-57-7, is a synthetic organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity. The compound also features a phenyl ring substituted with a piperazine moiety, specifically a 4-methyl-1-piperazinyl group, which contributes to its potential biological activity. The methanone functional group indicates the presence of a carbonyl (C=O) linked to the cyclopropyl and phenyl components, suggesting possible reactivity in various chemical environments. This compound may exhibit interesting pharmacological properties due to the presence of the piperazine ring, which is often associated with various therapeutic effects. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals. However, specific properties such as solubility, melting point, and biological activity would require empirical data for comprehensive characterization.
Formula:C16H22N2O
InChI:InChI=1S/C16H22N2O/c1-17-8-10-18(11-9-17)12-14-4-2-3-5-15(14)16(19)13-6-7-13/h2-5,13H,6-12H2,1H3
InChI key:InChIKey=FKYXNVRWTKIQBI-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)C2CC2)C=CC=C1)N3CCN(C)CC3
Synonyms:
  • Cyclopropyl[2-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
  • Methanone, cyclopropyl[2-[(4-methyl-1-piperazinyl)methyl]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.