CAS 898762-62-4
:1-Propanone, 3-(3-chlorophenyl)-1-(4-chlorophenyl)-
Description:
1-Propanone, 3-(3-chlorophenyl)-1-(4-chlorophenyl)-, also known by its CAS number 898762-62-4, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two chlorophenyl substituents, specifically a 3-chlorophenyl group and a 4-chlorophenyl group, contributing to its unique chemical properties. The presence of chlorine atoms enhances the compound's reactivity and influences its physical properties, such as solubility and boiling point. Typically, compounds with such substituents exhibit significant biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential applications in various chemical syntheses and as intermediates in organic chemistry. Additionally, the chlorinated phenyl groups may impart specific electronic characteristics, affecting the compound's behavior in chemical reactions. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with halogenated substituents.
Formula:C15H12Cl2O
InChI:InChI=1/C15H12Cl2O/c16-13-7-5-12(6-8-13)15(18)9-4-11-2-1-3-14(17)10-11/h1-3,5-8,10H,4,9H2
InChI key:InChIKey=FBODZBSXGUYQLO-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=C(Cl)C=C1)C2=CC(Cl)=CC=C2
Synonyms:- 1-Propanone, 3-(3-chlorophenyl)-1-(4-chlorophenyl)-
- 3-(3-Chlorophenyl)-1-(4-chlorophenyl)-1-propanone
- 4′-Chloro-3-(3-chlorophenyl)propiophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.