CAS 898762-67-9

Ethyl 2-[(4-methyl-1-piperazinyl)methyl]-γ-oxobenzenebutanoate

Description:

Ethyl 2-[(4-methyl-1-piperazinyl)methyl]-γ-oxobenzenebutanoate, with the CAS number 898762-67-9, is a chemical compound characterized by its complex structure, which includes an ethyl ester group, a piperazine moiety, and a γ-oxobenzenebutanoate framework. This compound typically exhibits properties associated with both its ester and piperazine functionalities, such as moderate solubility in organic solvents and potential bioactivity due to the presence of the piperazine ring, which is often found in pharmacologically active compounds. The presence of the γ-oxo group suggests that it may participate in various chemical reactions, including nucleophilic attacks or condensation reactions. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure allows for potential modifications that could enhance its pharmacokinetic properties or biological activity. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₁₈H₂₆N₂O₃

InChI: InChI=1S/C18H26N2O3/c1-3-23-18(22)9-8-17(21)16-7-5-4-6-15(16)14-20-12-10-19(2)11-13-20/h4-7H,3,8-14H2,1-2H3

InChI key: InChIKey=PKWYNUJDDDHGBL-UHFFFAOYSA-N

SMILES: C(CCC(OCC)=O)(=O)C1=C(CN2CCN(C)CC2)C=CC=C1

Synonyms:

• Benzenebutanoic acid, 2-[(4-methyl-1-piperazinyl)methyl]-γ-oxo-, ethyl ester
• Ethyl 2-[(4-methyl-1-piperazinyl)methyl]-γ-oxobenzenebutanoate

ethyl 4-[2-(4-methylpiperazinomethyl)phenyl]-4-oxobutyrate

CAS: 898762-67-9

Formula: C₁₈H₂₆N₂O₃

Purity: 97.0%

Molecular weight: 318.417

Ref: 10-F205503