CymitQuimica logo

CAS 898762-68-0

:

Ethyl 3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)-η-oxobenzeneoctanoate

Description:
Ethyl 3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)-η-oxobenzeneoctanoate is a complex organic compound characterized by its unique structural features, including a spirocyclic framework and multiple functional groups. The presence of the dioxane and azaspiro moieties suggests potential applications in medicinal chemistry, particularly in drug design, due to their ability to interact with biological targets. The ethyl ester functional group indicates that the compound may exhibit moderate lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the η-oxobenzene component may contribute to the compound's reactivity and potential for forming various derivatives. Overall, this compound's intricate structure and functional diversity make it a subject of interest for further research, particularly in the fields of organic synthesis and pharmacology. However, specific properties such as melting point, boiling point, and solubility would require empirical data for a comprehensive understanding of its behavior in different environments.
Formula:C24H35NO5
InChI:InChI=1S/C24H35NO5/c1-2-28-23(27)11-6-4-3-5-10-22(26)21-9-7-8-20(18-21)19-25-14-12-24(13-15-25)29-16-17-30-24/h7-9,18H,2-6,10-17,19H2,1H3
InChI key:InChIKey=YLZNCCUSJPRGNL-UHFFFAOYSA-N
SMILES:C(N1CCC2(CC1)OCCO2)C3=CC(C(CCCCCCC(OCC)=O)=O)=CC=C3
Synonyms:
  • Benzeneoctanoic acid, 3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)-η-oxo-, ethyl ester
  • Ethyl 3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)-η-oxobenzeneoctanoate
  • Ethyl 8-[3-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-8-oxooctanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.