CAS 898762-69-1

Ethyl 2-[(4-methyl-1-piperazinyl)methyl]-δ-oxobenzenepentanoate

Description:

Ethyl 2-[(4-methyl-1-piperazinyl)methyl]-δ-oxobenzenepentanoate, identified by its CAS number 898762-69-1, is a chemical compound that features a complex structure incorporating both an ester and a piperazine moiety. This compound typically exhibits characteristics common to esters, such as being a liquid at room temperature with a pleasant odor, and it is likely soluble in organic solvents while having limited solubility in water due to its larger molecular size and hydrophobic components. The presence of the piperazine ring suggests potential biological activity, as piperazine derivatives are often associated with pharmacological properties. The δ-oxobenzene structure indicates that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, making it of interest in medicinal chemistry and drug development. Overall, this compound's unique structure may contribute to its potential applications in pharmaceuticals or as a synthetic intermediate in organic synthesis.

Formula: C₁₉H₂₈N₂O₃

InChI: InChI=1S/C19H28N2O3/c1-3-24-19(23)10-6-9-18(22)17-8-5-4-7-16(17)15-21-13-11-20(2)12-14-21/h4-5,7-8H,3,6,9-15H2,1-2H3

InChI key: InChIKey=CUCNTGNXSXJFOY-UHFFFAOYSA-N

SMILES: C(C1=C(C(CCCC(OCC)=O)=O)C=CC=C1)N2CCN(C)CC2

Synonyms:

• Benzenepentanoic acid, 2-[(4-methyl-1-piperazinyl)methyl]-δ-oxo-, ethyl ester
• Ethyl 2-[(4-methyl-1-piperazinyl)methyl]-δ-oxobenzenepentanoate