CAS 898762-70-4

phenyl-[3-(thiomorpholinomethyl)phenyl]methanone

Description:

Phenyl-[3-(thiomorpholinomethyl)phenyl]methanone, identified by its CAS number 898762-70-4, is an organic compound characterized by its complex structure, which includes a phenyl group and a thiomorpholine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the thiomorpholine ring suggests that it may exhibit unique reactivity and biological activity, potentially interacting with various biological targets. Its ketone functional group contributes to its reactivity, making it a candidate for further chemical transformations. Additionally, the compound may possess interesting pharmacological properties, warranting investigation in medicinal chemistry. Overall, phenyl-[3-(thiomorpholinomethyl)phenyl]methanone represents a versatile structure that could be explored for applications in drug development and materials science.

Formula: C₁₈H₁₉NOS

InChI: InChI=1/C18H19NOS/c20-18(16-6-2-1-3-7-16)17-8-4-5-15(13-17)14-19-9-11-21-12-10-19/h1-8,13H,9-12,14H2

SMILES: c1ccc(cc1)C(=O)c1cccc(c1)CN1CCSCC1