CAS 898762-72-6

Methanone, (2-methylphenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (2-methylphenyl)[3-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of a thiomorpholine moiety suggests that it has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The compound features a 2-methylphenyl group, which contributes to its hydrophobic characteristics, while the thiomorpholine ring may enhance solubility and bioavailability. Additionally, the presence of multiple phenyl groups can influence its electronic properties and reactivity. Overall, this compound is likely to exhibit interesting chemical behavior, making it a subject of interest for further research in organic synthesis and drug development. Its specific properties, such as melting point, boiling point, and solubility, would require experimental determination or detailed computational analysis for precise characterization.

Formula: C₁₉H₂₁NOS

InChI: InChI=1S/C19H21NOS/c1-15-5-2-3-8-18(15)19(21)17-7-4-6-16(13-17)14-20-9-11-22-12-10-20/h2-8,13H,9-12,14H2,1H3

InChI key: InChIKey=PSSCTRYMFMCZGN-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCSCC2)=CC=C1)C3=C(C)C=CC=C3

Synonyms:

• 2-Methyl-3′-thiomorpholinomethyl benzophenone
• Methanone, (2-methylphenyl)[3-(4-thiomorpholinylmethyl)phenyl]-
• (2-Methylphenyl)[3-(4-thiomorpholinylmethyl)phenyl]methanone

2-methyl-3′-thiomorpholinomethyl benzophenone

CAS: 898762-72-6

Formula: C₁₉H₂₁NOS

Purity: 97.0%

Molecular weight: 311.44

Ref: 10-F204941