CAS 898762-74-8
:m-tolyl-[3-(thiomorpholinomethyl)phenyl]methanone
Description:
m-Tolyl-[3-(thiomorpholinomethyl)phenyl]methanone, identified by its CAS number 898762-74-8, is a chemical compound characterized by its complex structure, which includes a tolyl group and a thiomorpholine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the thiomorpholine ring suggests that it may possess unique pharmacological properties, potentially influencing its biological activity. Additionally, the methanone functional group indicates that it may participate in nucleophilic addition reactions, making it a candidate for further chemical modifications. Its molecular structure may also impart specific physical properties, such as melting and boiling points, which are essential for applications in pharmaceuticals or materials science. Overall, m-tolyl-[3-(thiomorpholinomethyl)phenyl]methanone represents a compound of interest in organic synthesis and medicinal chemistry, warranting further investigation into its potential uses and effects.
Formula:C19H21NOS
InChI:InChI=1/C19H21NOS/c1-15-4-2-6-17(12-15)19(21)18-7-3-5-16(13-18)14-20-8-10-22-11-9-20/h2-7,12-13H,8-11,14H2,1H3
SMILES:Cc1cccc(c1)C(=O)c1cccc(c1)CN1CCSCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.