CymitQuimica logo

CAS 898762-80-6

:

Methanone, (3-methoxyphenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

Description:
Methanone, (3-methoxyphenyl)[3-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a methoxy group (-OCH3) on one of the phenyl rings enhances its solubility in organic solvents and may influence its reactivity and biological activity. The thiomorpholine moiety introduces a sulfur atom into the structure, which can affect the compound's pharmacological properties, potentially enhancing its interaction with biological targets. This compound may exhibit various characteristics such as moderate to high lipophilicity due to its aromatic components, which can influence its absorption and distribution in biological systems. Additionally, the presence of multiple functional groups suggests potential for diverse chemical reactivity, making it a candidate for further investigation in medicinal chemistry or material science. Overall, the unique combination of functional groups and structural features may confer specific properties that warrant exploration in various applications, including drug development or as a chemical intermediate.
Formula:C19H21NO2S
InChI:InChI=1S/C19H21NO2S/c1-22-18-7-3-6-17(13-18)19(21)16-5-2-4-15(12-16)14-20-8-10-23-11-9-20/h2-7,12-13H,8-11,14H2,1H3
InChI key:InChIKey=OIRFWPSKUXJMAJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCSCC2)=CC=C1)C3=CC(OC)=CC=C3
Synonyms:
  • (3-Methoxyphenyl)[3-(4-thiomorpholinylmethyl)phenyl]methanone
  • 3-Methoxy-3′-thiomorpholinomethyl benzophenone
  • Methanone, (3-methoxyphenyl)[3-(4-thiomorpholinylmethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.