CAS 898762-81-7

Methanone, [2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](3-methylphenyl)-

Description:

Methanone, specifically the compound known as [2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](3-methylphenyl)-, is a complex organic molecule characterized by its unique structural features. This compound contains a methanone functional group, which is indicative of a ketone, and is further substituted with a phenyl group and a pyrrolidine moiety. The presence of the 2,5-dihydro-1H-pyrrol-1-yl group suggests potential for various interactions due to its nitrogen atom, which can participate in hydrogen bonding or coordination with other molecules. The additional 3-methylphenyl group contributes to the overall hydrophobic character of the molecule, influencing its solubility and reactivity. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a fascinating example of a substituted ketone with potential applications in various fields.

Formula: C₁₉H₁₉NO

InChI: InChI=1S/C19H19NO/c1-15-7-6-9-16(13-15)19(21)18-10-3-2-8-17(18)14-20-11-4-5-12-20/h2-10,13H,11-12,14H2,1H3

InChI key: InChIKey=NIXNGBYMBRZIGH-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(C)=CC=C2)C=CC=C1)N3CC=CC3

Synonyms:

• [2-(2,5-Dihydro-1H-pyrrol-1-ylmethyl)phenyl](3-methylphenyl)methanone
• Methanone, [2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](3-methylphenyl)-

3'-methyl-2-(3-pyrrolinomethyl) benzophenone

CAS: 898762-81-7

Purity: 97.0%

Molecular weight: 277.367

Ref: 10-F205510