CAS 898762-91-9

2-[2-(2,5-dihydropyrrol-1-ylmethyl)benzoyl]benzonitrile

Description:

2-[2-(2,5-dihydropyrrol-1-ylmethyl)benzoyl]benzonitrile, with the CAS number 898762-91-9, is a chemical compound characterized by its complex structure, which includes a benzoyl group and a benzonitrile moiety. This compound features a dihydropyrrole ring, contributing to its potential biological activity. The presence of the nitrile functional group indicates that it may exhibit unique reactivity and properties, such as being a potential ligand in coordination chemistry or a precursor in organic synthesis. The dihydropyrrole component may also suggest possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to various bioactive compounds. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic rings and the nitrogen-containing heterocycle. Overall, this compound's characteristics make it a subject of interest for further research in both synthetic and medicinal chemistry contexts.

Formula: C₁₉H₁₆N₂O

InChI: InChI=1/C19H16N2O/c20-13-15-7-1-3-9-17(15)19(22)18-10-4-2-8-16(18)14-21-11-5-6-12-21/h1-10H,11-12,14H2

SMILES: c1ccc(c(c1)C#N)C(=O)c1ccccc1CN1CC=CC1

2-cyano-2'-(3-pyrrolinomethyl) benzophenone

CAS: 898762-91-9

Purity: 97.0%

Molecular weight: 288.35

Ref: 10-F205515