CAS 898762-96-4

Methanone, [2-(methylthio)phenyl][3-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, [2-(methylthio)phenyl][3-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct phenyl rings. One of the phenyl groups is substituted with a methylthio group, while the other features a thiomorpholine moiety, indicating the presence of sulfur in its structure. This compound is likely to exhibit properties typical of ketones, such as being a polar solvent and having potential reactivity in nucleophilic addition reactions. The presence of sulfur-containing groups may also impart unique characteristics, such as increased lipophilicity and potential biological activity. Methanone derivatives often find applications in pharmaceuticals and agrochemicals due to their ability to interact with biological systems. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound represents a class of organic molecules with potential utility in various chemical and biological applications.

Formula: C₁₉H₂₁NOS₂

InChI: InChI=1S/C19H21NOS2/c1-22-18-8-3-2-7-17(18)19(21)16-6-4-5-15(13-16)14-20-9-11-23-12-10-20/h2-8,13H,9-12,14H2,1H3

InChI key: InChIKey=UFTCKEAEUOPAEW-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(SC)C=CC=C1)C2=CC(CN3CCSCC3)=CC=C2

Synonyms:

• Methanone, [2-(methylthio)phenyl][3-(4-thiomorpholinylmethyl)phenyl]-