CymitQuimica logo

CAS 898763-03-6

:

(3-chlorophenyl)-[3-(thiomorpholinomethyl)phenyl]methanone

Description:
The chemical substance known as (3-chlorophenyl)-[3-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898763-03-6, is characterized by its complex structure that includes a chlorophenyl group and a thiomorpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the phenyl rings and the thiomorpholine moiety. It is likely to be a solid at room temperature, given the presence of multiple aromatic rings, which often contribute to higher melting points. The chlorophenyl group may impart certain electronic properties, influencing its reactivity and potential applications in medicinal chemistry or as a synthetic intermediate. The thiomorpholine component suggests potential interactions with biological systems, possibly affecting its solubility and bioavailability. Overall, this compound may be of interest in research related to pharmaceuticals or agrochemicals, where its unique structural features could lead to specific biological activities or chemical reactivity.
Formula:C18H18ClNOS
InChI:InChI=1/C18H18ClNOS/c19-17-6-2-5-16(12-17)18(21)15-4-1-3-14(11-15)13-20-7-9-22-10-8-20/h1-6,11-12H,7-10,13H2
SMILES:c1cc(cc(c1)C(=O)c1cccc(c1)Cl)CN1CCSCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.