CAS 898763-04-7

[2-(2,5-dihydropyrrol-1-ylmethyl)phenyl]-(4-methylsulfanylphenyl)methanone

Description:

The chemical substance known as [2-(2,5-dihydropyrrol-1-ylmethyl)phenyl]-(4-methylsulfanylphenyl)methanone, with the CAS number 898763-04-7, is a synthetic organic compound characterized by its complex structure, which includes a phenyl group, a methanone functional group, and a dihydropyrrole moiety. This compound features a combination of aromatic and aliphatic components, contributing to its potential biological activity. The presence of the methylsulfanyl group suggests possible interactions with biological systems, as sulfur-containing compounds often exhibit unique reactivity and properties. The dihydropyrrole ring may also impart specific pharmacological characteristics, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on its molecular structure, influencing its applications in research and industry. Overall, this substance may be explored for its potential therapeutic uses, although detailed studies would be necessary to fully understand its properties and biological effects.

Formula: C₁₉H₁₉NOS

InChI: InChI=1/C19H19NOS/c1-22-17-10-8-15(9-11-17)19(21)18-7-3-2-6-16(18)14-20-12-4-5-13-20/h2-11H,12-14H2,1H3

SMILES: CSc1ccc(cc1)C(=O)c1ccccc1CN1CC=CC1

2-(3-pyrrolinomethyl)-4'-thiomethylbenzophenone

CAS: 898763-04-7

Purity: 97.0%

Molecular weight: 309.43

Ref: 10-F205522