CAS 898763-05-8

Methanone, (4-chlorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (4-chlorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and a chlorophenyl moiety. The presence of a thiomorpholine ring indicates that the compound has a sulfur atom incorporated into a morpholine-like structure, which can influence its reactivity and biological activity. The chlorophenyl group contributes to the compound's lipophilicity and may enhance its interaction with biological targets. This compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, including potential pharmacological activities. Its specific applications or uses may vary, but compounds with similar structures are often investigated for their roles in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of multiple functional groups suggests that it may participate in various chemical reactions, making it a subject of interest in synthetic organic chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₈H₁₈ClNOS

InChI: InChI=1S/C18H18ClNOS/c19-17-6-4-15(5-7-17)18(21)16-3-1-2-14(12-16)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

InChI key: InChIKey=TVLRPINHYNXHMQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCSCC2)=CC=C1)C3=CC=C(Cl)C=C3

Synonyms:

• (4-Chlorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]methanone
• 4′-Chloro-3-thiomorpholinomethyl benzophenone
• Methanone, (4-chlorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

4′-chloro-3-thiomorpholinomethyl benzophenone

CAS: 898763-05-8

Formula: C₁₈H₁₈ClNOS

Purity: 97.0%

Molecular weight: 331.86

Ref: 10-F204958