CAS 898763-06-9

Methanone, (3-bromophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (3-bromophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of a bromine atom at the 3-position of one of the phenyl groups contributes to its reactivity and potential applications in medicinal chemistry. The compound also features a pyrrolidine moiety, which may influence its biological activity and solubility. Typically, such compounds are studied for their potential pharmacological properties, including anti-cancer or anti-inflammatory effects. The molecular interactions of this substance can be influenced by its stereochemistry and the electronic effects of the bromine substituent. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Safety data and handling precautions are essential when working with this compound, as it may exhibit toxicity or other hazardous properties.

Formula: C₁₈H₁₆BrNO

InChI: InChI=1S/C18H16BrNO/c19-16-8-5-7-14(12-16)18(21)17-9-2-1-6-15(17)13-20-10-3-4-11-20/h1-9,12H,10-11,13H2

InChI key: InChIKey=SEOBFOHKAQYQKQ-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(Br)=CC=C2)C=CC=C1)N3CC=CC3

Synonyms:

• (3-Bromophenyl)[2-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (3-bromophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

3'-bromo-2-(3-pyrrolinomethyl) benzophenone

CAS: 898763-06-9

Purity: 97.0%

Molecular weight: 342.236

Ref: 10-F205523