CAS 898763-09-2

Methanone, (4-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (4-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and a fluorophenyl moiety. The presence of a thiomorpholine ring indicates that the compound contains a sulfur atom within a morpholine-like structure, contributing to its potential biological activity. The fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. This compound may exhibit interesting pharmacological properties due to the combination of the fluorinated aromatic system and the thiomorpholine substituent, which could be relevant in medicinal chemistry. Its specific applications and effects would depend on further studies, including its synthesis, stability, and reactivity under various conditions. As with many organic compounds, safety and handling precautions are essential, particularly due to the presence of sulfur and fluorine, which can pose specific hazards.

Formula: C₁₈H₁₈FNOS

InChI: InChI=1/C18H18FNOS/c19-17-6-4-15(5-7-17)18(21)16-3-1-2-14(12-16)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

InChI key: InChIKey=ZFMXZKJLJPOSFV-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCSCC2)=CC=C1)C3=CC=C(F)C=C3

Synonyms:

• (4-Fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]methanone
• Methanone, (4-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

4′-fluoro-3-thiomorpholinomethyl benzophenone

CAS: 898763-09-2

Formula: C₁₈H₁₈FNOS

Purity: 97.0%

Molecular weight: 315.41

Ref: 10-F204960