CAS 898763-11-6
:(2,3-dimethylphenyl)-[3-(thiomorpholinomethyl)phenyl]methanone
Description:
The chemical substance known as (2,3-dimethylphenyl)-[3-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898763-11-6, is a complex organic compound characterized by its unique molecular structure. It features a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of a thiomorpholine moiety suggests that it may exhibit interesting pharmacological properties, as thiomorpholines are often associated with biological activity. The dimethylphenyl groups contribute to the compound's hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. Additionally, the compound's molecular architecture may allow for specific interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. Overall, this compound's structural features suggest it could be of interest in the development of new therapeutic agents or as a tool in chemical biology. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C20H23NOS
InChI:InChI=1/C20H23NOS/c1-15-5-3-8-19(16(15)2)20(22)18-7-4-6-17(13-18)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3
SMILES:Cc1cccc(c1C)C(=O)c1cccc(c1)CN1CCSCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.