CAS 898763-16-1

Methanone, (2,5-dimethylphenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (2,5-dimethylphenyl)[3-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,5-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, contributing to its hydrophobic character and potential for steric hindrance. The compound also features a thiomorpholine moiety, which introduces a sulfur atom into the structure, enhancing its potential for biological activity and interaction with various biological targets. This compound may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, typical of many organic molecules with large aromatic systems. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components that can influence biological interactions. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity associated with certain functional groups.

Formula: C₂₀H₂₃NOS

InChI: InChI=1S/C20H23NOS/c1-15-6-7-16(2)19(12-15)20(22)18-5-3-4-17(13-18)14-21-8-10-23-11-9-21/h3-7,12-13H,8-11,14H2,1-2H3

InChI key: InChIKey=GOJVWAGXQZAJPY-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCSCC2)=CC=C1)C3=C(C)C=CC(C)=C3

Synonyms:

• 2,5-Dimethyl-3′-thiomorpholinomethyl benzophenone
• Methanone, (2,5-dimethylphenyl)[3-(4-thiomorpholinylmethyl)phenyl]-
• (2,5-Dimethylphenyl)[3-(4-thiomorpholinylmethyl)phenyl]methanone

2,5-dimethyl-3′-thiomorpholinomethyl benzophenone

CAS: 898763-16-1

Formula: C₂₀H₂₃NOS

Purity: 97.0%

Molecular weight: 325.47

Ref: 10-F204963