CAS 898763-19-4
:(2,6-dimethylphenyl)-[3-(thiomorpholinomethyl)phenyl]methanone
Description:
The chemical substance known as (2,6-dimethylphenyl)-[3-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898763-19-4, is a synthetic organic compound characterized by its complex molecular structure. It features a ketone functional group, which is indicative of its potential reactivity and applications in organic synthesis. The presence of a thiomorpholine moiety suggests that the compound may exhibit unique pharmacological properties, possibly influencing its interaction with biological systems. The dimethylphenyl groups contribute to its hydrophobic characteristics, which can affect solubility and permeability in biological contexts. This compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents, due to its structural features that could facilitate interactions with specific biological targets. Additionally, the presence of multiple functional groups allows for potential modifications, making it a versatile candidate for further chemical exploration. As with many synthetic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity.
Formula:C20H23NOS
InChI:InChI=1/C20H23NOS/c1-15-5-3-6-16(2)19(15)20(22)18-8-4-7-17(13-18)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3
SMILES:Cc1cccc(C)c1C(=O)c1cccc(c1)CN1CCSCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.