CAS 898763-24-1

Methanone, (2,5-dichlorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (2,5-dichlorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a dichlorophenyl group indicates that the compound has two chlorine atoms substituted on a phenyl ring, which can influence its reactivity and biological activity. The incorporation of a piperazine moiety suggests potential pharmacological properties, as piperazine derivatives are often found in various therapeutic agents. This compound may exhibit properties such as lipophilicity due to its aromatic components, which can affect its solubility and permeability in biological systems. Additionally, the presence of multiple functional groups may contribute to its potential interactions with biological targets. Overall, the characteristics of this compound make it of interest in medicinal chemistry and drug development, particularly in the context of designing compounds with specific biological activities.

Formula: C₁₉H₂₀Cl₂N₂O

InChI: InChI=1S/C19H20Cl2N2O/c1-22-8-10-23(11-9-22)13-14-2-4-15(5-3-14)19(24)17-12-16(20)6-7-18(17)21/h2-7,12H,8-11,13H2,1H3

InChI key: InChIKey=ZSQRLMNQMLTDGX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCN(C)CC2)C=C1)C3=C(Cl)C=CC(Cl)=C3

Synonyms:

• 2,5-Dichloro-4′-(4-methylpiperazinomethyl) benzophenone
• (2,5-Dichlorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (2,5-dichlorophenyl)[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-