CAS 898763-25-2

(3,5-dimethylphenyl)-[3-(thiomorpholinomethyl)phenyl]methanone

Description:

The chemical substance known as (3,5-dimethylphenyl)-[3-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898763-25-2, is a compound that features a ketone functional group and incorporates both aromatic and heterocyclic structures. Its molecular framework includes a dimethyl-substituted phenyl group and a thiomorpholine moiety, which contributes to its potential biological activity. The presence of the thiomorpholine ring suggests that this compound may exhibit properties relevant to medicinal chemistry, possibly influencing its interaction with biological targets. The compound's structure indicates it may possess lipophilic characteristics due to the aromatic rings, which can affect its solubility and permeability in biological systems. Additionally, the specific arrangement of substituents can influence its reactivity and stability. Overall, this compound may be of interest in research areas such as drug development or materials science, although detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₂₀H₂₃NOS

InChI: InChI=1/C20H23NOS/c1-15-10-16(2)12-19(11-15)20(22)18-5-3-4-17(13-18)14-21-6-8-23-9-7-21/h3-5,10-13H,6-9,14H2,1-2H3

SMILES: Cc1cc(C)cc(c1)C(=O)c1cccc(c1)CN1CCSCC1

3,5-dimethyl-3′-thiomorpholinomethyl benzophenone

CAS: 898763-25-2

Formula: C₂₀H₂₃NOS

Purity: 97.0%

Molecular weight: 325.47

Ref: 10-F204966