CAS 898763-28-5

(4-bromo-3-fluoro-phenyl)-[3-(thiomorpholinomethyl)phenyl]methanone

Description:

(4-bromo-3-fluoro-phenyl)-[3-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898763-28-5, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with bromine and fluorine atoms, as well as a thiomorpholine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic chemistry, making it of interest in medicinal chemistry and drug development. The presence of halogen substituents can influence its reactivity, solubility, and biological activity, while the thiomorpholine group may enhance its pharmacological properties. The compound is likely to be a solid at room temperature, with potential applications in various fields, including pharmaceuticals, due to its unique structural features. As with many synthetic compounds, safety and handling precautions are essential, and its behavior in biological systems would require thorough investigation to understand its efficacy and toxicity.

Formula: C₁₈H₁₇BrFNOS

InChI: InChI=1/C18H17BrFNOS/c19-16-5-4-15(11-17(16)20)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2

SMILES: c1cc(cc(c1)C(=O)c1ccc(c(c1)F)Br)CN1CCSCC1

4-bromo-3-fluoro-3′-thiomorpholinomethyl benzophenone

CAS: 898763-28-5

Formula: C₁₈H₁₇BrFNOS

Purity: 97.0%

Molecular weight: 394.3

Ref: 10-F204967