CAS 898763-31-0
:(4-chloro-3-fluoro-phenyl)-[3-(thiomorpholinomethyl)phenyl]methanone
Description:
The chemical substance known as (4-chloro-3-fluoro-phenyl)-[3-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898763-31-0, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both chlorine and fluorine atoms, as well as a thiomorpholine moiety. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of aromatic rings, which can influence its solubility in organic solvents. The presence of the thiomorpholine group may impart unique biological activities, making it of interest in medicinal chemistry. Additionally, the halogen substituents can enhance the compound's reactivity and potential interactions with biological targets. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific therapeutic effects. As with many synthetic compounds, safety and handling precautions are essential, and its behavior in biological systems would require thorough investigation to understand its pharmacokinetics and toxicity.
Formula:C18H17ClFNOS
InChI:InChI=1/C18H17ClFNOS/c19-16-5-4-15(11-17(16)20)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2
SMILES:c1cc(cc(c1)C(=O)c1ccc(c(c1)F)Cl)CN1CCSCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.