CAS 898763-34-3

Methanone, (3-chloro-4-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3-chloro-4-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique chemical reactivity and potential biological activity. The thiomorpholine moiety introduces a sulfur atom into the structure, which can enhance solubility and influence pharmacokinetic properties. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in therapeutic areas, particularly in the development of pharmaceuticals. As with many synthetic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Safety and handling precautions should be observed due to the presence of halogenated groups, which can pose environmental and health risks.

Formula: C₁₈H₁₇ClFNOS

InChI: InChI=1/C18H17ClFNOS/c19-16-11-15(4-5-17(16)20)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2

InChI key: InChIKey=OQNNRIKIUOBFAX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCSCC2)=CC=C1)C3=CC(Cl)=C(F)C=C3

Synonyms:

• (3-Chloro-4-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]methanone
• Methanone, (3-chloro-4-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-
• 3-Chloro-4-fluoro-3′-thiomorpholinomethyl benzophenone

3-chloro-4-fluoro-3′-thiomorpholinomethyl benzophenone

CAS: 898763-34-3

Formula: C₁₈H₁₇ClFNOS

Purity: 97.0%

Molecular weight: 349.85

Ref: 10-F204969