CAS 898763-37-6

Methanone, (2-chlorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (2-chlorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a 2-chlorophenyl group indicates that a chlorine atom is substituted on the second position of a phenyl ring, contributing to its reactivity and potential biological activity. The compound also features a thiomorpholine moiety, which is a six-membered ring containing sulfur and nitrogen, suggesting potential interactions with biological systems, particularly in medicinal chemistry. The overall structure implies that it may exhibit properties such as lipophilicity due to the aromatic components, and it may engage in hydrogen bonding or other interactions due to the presence of the thiomorpholine group. This compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, given its unique structural features. However, specific properties such as solubility, melting point, and biological activity would require empirical investigation.

Formula: C₁₈H₁₈ClNOS

InChI: InChI=1/C18H18ClNOS/c19-17-7-2-1-6-16(17)18(21)15-5-3-4-14(12-15)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

InChI key: InChIKey=QFFCLSAZAPATOC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCSCC2)=CC=C1)C3=C(Cl)C=CC=C3

Synonyms:

• (2-Chlorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]methanone
• 2-Chloro-3′-thiomorpholinomethyl benzophenone
• Methanone, (2-chlorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-