CAS 898763-43-4

Methanone, [3-(4-thiomorpholinylmethyl)phenyl][2-(trifluoromethyl)phenyl]-

Description:

Methanone, specifically the compound known as [3-(4-thiomorpholinylmethyl)phenyl][2-(trifluoromethyl)phenyl]-, is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and various substituents that contribute to its chemical properties. The presence of a thiomorpholine ring suggests potential for unique reactivity and interactions, particularly in biological systems. The trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, which can influence the compound's pharmacokinetics and biological activity. This compound may exhibit properties such as moderate to high solubility in organic solvents, and its stability can be affected by environmental factors like temperature and pH. Additionally, the presence of multiple aromatic rings may contribute to its electronic properties, potentially allowing for π-π stacking interactions. Overall, the characteristics of this compound make it of interest in medicinal chemistry and material science, although specific applications would depend on further research and evaluation of its biological activity and safety profile.

Formula: C₁₉H₁₈F₃NOS

InChI: InChI=1S/C19H18F3NOS/c20-19(21,22)17-7-2-1-6-16(17)18(24)15-5-3-4-14(12-15)13-23-8-10-25-11-9-23/h1-7,12H,8-11,13H2

InChI key: InChIKey=VBZXXGNGZLMGKI-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C(F)(F)F)C=CC=C1)C2=CC(CN3CCSCC3)=CC=C2

Synonyms:

• 3′-Thiomorpholinomethyl-2-trifluoromethyl-benzophenone
• [3-(4-Thiomorpholinylmethyl)phenyl][2-(trifluoromethyl)phenyl]methanone
• Methanone, [3-(4-thiomorpholinylmethyl)phenyl][2-(trifluoromethyl)phenyl]-