CAS 898763-47-8

(2-Chlorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone

Description:

The chemical substance known as (2-Chlorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone, with the CAS number 898763-47-8, is a synthetic organic compound characterized by its complex structure, which includes a chlorophenyl group and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic systems, contributing to its potential biological activity. The presence of the chlorophenyl group may enhance lipophilicity, influencing its solubility and interaction with biological membranes. Additionally, the pyrrolidine ring can impart unique reactivity and stability characteristics. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. The specific functional groups present suggest that it may engage in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Overall, this compound's structural features make it a subject of interest in research related to drug development and chemical synthesis.

Formula: C₁₈H₁₆ClNO

InChI: InChI=1S/C18H16ClNO/c19-17-10-4-3-9-16(17)18(21)15-8-2-1-7-14(15)13-20-11-5-6-12-20/h1-10H,11-13H2

InChI key: InChIKey=VXOSCJREOHZSLH-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(Cl)C=CC=C2)C=CC=C1)N3CC=CC3

Synonyms:

• Methanone, (2-chlorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-
• (2-Chlorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone

2-chloro-2'-(3-pyrrolinomethyl) benzophenone

CAS: 898763-47-8

Purity: 97.0%

Molecular weight: 297.78

Ref: 10-F205538