CymitQuimica logo

CAS 898763-49-0

:

[3-(thiomorpholinomethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone

Description:
The chemical substance known as [3-(thiomorpholinomethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone, with the CAS number 898763-49-0, is characterized by its complex molecular structure, which includes a phenyl ring substituted with a thiomorpholine group and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential lipophilicity due to the presence of the trifluoromethyl group, which can enhance its biological activity and solubility in organic solvents. The thiomorpholine moiety may contribute to its pharmacological properties, potentially influencing its interaction with biological targets. Additionally, the presence of the carbonyl group in the methanone structure suggests reactivity typical of ketones, which can participate in various chemical reactions, including nucleophilic additions. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications, although specific biological activity and safety profiles would require further investigation through experimental studies.
Formula:C19H18F3NOS
InChI:InChI=1/C19H18F3NOS/c20-19(21,22)17-6-4-15(5-7-17)18(24)16-3-1-2-14(12-16)13-23-8-10-25-11-9-23/h1-7,12H,8-11,13H2
SMILES:c1cc(cc(c1)C(=O)c1ccc(cc1)C(F)(F)F)CN1CCSCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.