CAS 898763-51-4
:cyclopentyl-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone
Description:
Cyclopentyl-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, identified by its CAS number 898763-51-4, is a synthetic organic compound characterized by its complex structure, which includes a cyclopentyl group, a phenyl ring, and a piperazine moiety. This compound typically exhibits properties associated with its functional groups, such as moderate lipophilicity due to the presence of the cyclopentyl and phenyl groups, which may influence its solubility in organic solvents. The piperazine ring can contribute to its biological activity, potentially interacting with various receptors or enzymes in biological systems. The methanone functional group suggests that it may participate in further chemical reactions, such as nucleophilic attacks or condensation reactions. Overall, this compound may be of interest in medicinal chemistry for its potential pharmacological applications, although specific biological activity and safety profiles would require further investigation through empirical studies.
Formula:C18H26N2O
InChI:InChI=1/C18H26N2O/c1-19-10-12-20(13-11-19)14-15-6-8-17(9-7-15)18(21)16-4-2-3-5-16/h6-9,16H,2-5,10-14H2,1H3
SMILES:CN1CCN(CC1)Cc1ccc(cc1)C(=O)C1CCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.