CAS 898763-52-5

Methanone, (4-bromo-2-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (4-bromo-2-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of bromine and fluorine substituents on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The thiomorpholine moiety introduces a heterocyclic element, which may enhance solubility and interaction with biological targets. This compound is likely to exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. As with many synthetic compounds, understanding its stability, solubility, and reactivity under different conditions is crucial for its practical applications. Safety and handling considerations are also important, given the presence of halogenated substituents, which can affect toxicity and environmental impact.

Formula: C₁₈H₁₇BrFNOS

InChI: InChI=1S/C18H17BrFNOS/c19-15-4-5-16(17(20)11-15)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2

InChI key: InChIKey=WYFGRJDUBAULHW-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(Br)C=C1)C2=CC(CN3CCSCC3)=CC=C2

Synonyms:

• 4-Bromo-2-fluoro-3′-thiomorpholinomethyl-benzophenone
• Methanone, (4-bromo-2-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-
• (4-Bromo-2-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]methanone