CAS 898763-55-8
:(2-chloro-4-fluoro-phenyl)-[3-(thiomorpholinomethyl)phenyl]methanone
Description:
The chemical substance known as (2-chloro-4-fluoro-phenyl)-[3-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898763-55-8, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both chlorine and fluorine atoms, as well as a thiomorpholine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to its unique functional groups. The presence of the thiomorpholine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may impart specific solubility characteristics, influencing its behavior in various solvents and biological systems. Additionally, the compound's reactivity can be influenced by the electron-withdrawing effects of the halogen substituents, which may affect its stability and reactivity in chemical reactions. Overall, this compound represents a class of molecules that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C18H17ClFNOS
InChI:InChI=1/C18H17ClFNOS/c19-17-11-15(20)4-5-16(17)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2
SMILES:c1cc(cc(c1)C(=O)c1ccc(cc1Cl)F)CN1CCSCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.