CAS 898763-57-0

Ethyl 4-[(4-methyl-1-piperazinyl)methyl]-γ-oxobenzenebutanoate

Description:

Ethyl 4-[(4-methyl-1-piperazinyl)methyl]-γ-oxobenzenebutanoate, with CAS number 898763-57-0, is a chemical compound characterized by its complex structure, which includes an ethyl ester group, a piperazine moiety, and a γ-oxobenzenebutanoate framework. This compound typically exhibits properties associated with both its ester and piperazine functionalities, such as moderate solubility in organic solvents and potential bioactivity due to the presence of the piperazine ring, which is often found in pharmacologically active compounds. The γ-oxo group contributes to its reactivity, potentially allowing for further chemical modifications. Its molecular structure suggests it may interact with biological systems, making it of interest in medicinal chemistry. Additionally, the presence of the ethyl group may influence its lipophilicity, affecting its absorption and distribution in biological contexts. Overall, this compound's unique characteristics make it a subject of interest for further research, particularly in the fields of drug development and synthetic chemistry.

Formula: C₁₈H₂₆N₂O₃

InChI: InChI=1S/C18H26N2O3/c1-3-23-18(22)9-8-17(21)16-6-4-15(5-7-16)14-20-12-10-19(2)11-13-20/h4-7H,3,8-14H2,1-2H3

InChI key: InChIKey=GVHCDIZODDPFQI-UHFFFAOYSA-N

SMILES: C(CCC(OCC)=O)(=O)C1=CC=C(CN2CCN(C)CC2)C=C1

Synonyms:

• Benzenebutanoic acid, 4-[(4-methyl-1-piperazinyl)methyl]-γ-oxo-, ethyl ester
• Ethyl 4-[(4-methyl-1-piperazinyl)methyl]-γ-oxobenzenebutanoate

Ethyl 4-[4-(4-methylpiperazinomethyl)phenyl]-4-oxobutyrate

CAS: 898763-57-0

Formula: C₁₈H₂₆N₂O₃

Purity: 97.0%

Molecular weight: 318.417

Ref: 10-F204593