CymitQuimica logo

CAS 898763-58-1

:

Methanone, (3-chloro-5-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

Description:
Methanone, (3-chloro-5-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its unique chemical reactivity and potential biological activity. The thiomorpholine moiety introduces a sulfur atom into the structure, which can enhance solubility and influence pharmacokinetic properties. This compound may exhibit interesting interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in areas such as pharmaceuticals, where modifications to the aromatic rings can lead to variations in activity and selectivity. As with many synthetic compounds, understanding its stability, solubility, and reactivity under various conditions is crucial for its application in research and industry. Safety and handling precautions should be observed due to the presence of halogenated substituents, which can impart toxicity or environmental concerns.
Formula:C18H17ClFNOS
InChI:InChI=1S/C18H17ClFNOS/c19-16-9-15(10-17(20)11-16)18(22)14-3-1-2-13(8-14)12-21-4-6-23-7-5-21/h1-3,8-11H,4-7,12H2
InChI key:InChIKey=DGEZMUWQXWUGOG-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=CC(F)=C1)C2=CC(CN3CCSCC3)=CC=C2
Synonyms:
  • Methanone, (3-chloro-5-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-
  • 3-Chloro-5-fluoro-3′-thiomorpholinomethyl-benzophenone
  • (3-Chloro-5-fluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.