CAS 898763-60-5

Ethyl 4-[(4-methyl-1-piperazinyl)methyl]-δ-oxobenzenepentanoate

Description:

Ethyl 4-[(4-methyl-1-piperazinyl)methyl]-δ-oxobenzenepentanoate, identified by its CAS number 898763-60-5, is a chemical compound characterized by its complex structure, which includes an ethyl ester group, a piperazine moiety, and a ketone functional group. This compound typically exhibits properties associated with both lipophilicity and hydrophilicity due to the presence of various functional groups, making it potentially soluble in organic solvents while also having some degree of solubility in water. The piperazine ring contributes to its biological activity, often enhancing interactions with biological targets, which may include receptors or enzymes. The presence of the δ-oxobenzene structure suggests potential reactivity and the ability to participate in various chemical reactions, including nucleophilic attacks or electrophilic substitutions. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential pharmacological properties, although specific biological activities would require further investigation through empirical studies.

Formula: C₁₉H₂₈N₂O₃

InChI: InChI=1S/C19H28N2O3/c1-3-24-19(23)6-4-5-18(22)17-9-7-16(8-10-17)15-21-13-11-20(2)12-14-21/h7-10H,3-6,11-15H2,1-2H3

InChI key: InChIKey=WOIPOGHZFWHHGY-UHFFFAOYSA-N

SMILES: C(C1=CC=C(C(CCCC(OCC)=O)=O)C=C1)N2CCN(C)CC2

Synonyms:

• Benzenepentanoic acid, 4-[(4-methyl-1-piperazinyl)methyl]-δ-oxo-, ethyl ester
• Ethyl 4-[(4-methyl-1-piperazinyl)methyl]-δ-oxobenzenepentanoate

Ethyl 5-[4-(4-methylpiperazinomethyl)phenyl]-5-oxovalerate

CAS: 898763-60-5

Formula: C₁₉H₂₈N₂O₃

Purity: 97.0%

Molecular weight: 332.444

Ref: 10-F204594