CAS 898763-62-7

Methanone, (4-bromo-2-fluorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (4-bromo-2-fluorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique structural features. It contains a methanone functional group, which is indicative of a ketone, and is substituted with a 4-bromo and a 2-fluoro group on a phenyl ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of a pyrrolidine moiety suggests that it may exhibit interesting biological activity, as pyrrolidine derivatives are often explored for their pharmacological properties. This compound's molecular structure implies a degree of steric hindrance and electronic effects due to the halogen substituents, which can influence its chemical behavior and interactions. Additionally, the presence of multiple aromatic rings may enhance its stability and lipophilicity, making it a candidate for various chemical reactions or as a lead compound in drug development. Overall, this compound exemplifies the complexity and diversity of organic molecules used in advanced chemical research.

Formula: C₁₈H₁₅BrFNO

InChI: InChI=1S/C18H15BrFNO/c19-14-7-8-16(17(20)11-14)18(22)15-6-2-1-5-13(15)12-21-9-3-4-10-21/h1-8,11H,9-10,12H2

InChI key: InChIKey=KHXPQVXQNVTUFZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CC=CC2)C=CC=C1)C3=C(F)C=C(Br)C=C3

Synonyms:

• (4-Bromo-2-fluorophenyl)[2-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (4-bromo-2-fluorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

4-bromo-2-fluoro-2'-(3-pyrrolinomethyl) benzophenone

CAS: 898763-62-7

Purity: 97.0%

Molecular weight: 360.226

Ref: 10-F205543