CAS 898763-63-8

Ethyl 4-[(4-methyl-1-piperazinyl)methyl]-ε-oxobenzenehexanoate

Description:

Ethyl 4-[(4-methyl-1-piperazinyl)methyl]-ε-oxobenzenehexanoate, identified by its CAS number 898763-63-8, is a chemical compound that features a complex structure incorporating both an ester and a piperazine moiety. This compound typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid with a pleasant odor. Its molecular structure suggests it may possess moderate solubility in organic solvents while being less soluble in water due to the hydrophobic nature of the aromatic and aliphatic components. The presence of the piperazine ring indicates potential biological activity, as piperazine derivatives are often explored for their pharmacological properties. Additionally, the compound may demonstrate stability under standard conditions but could be sensitive to extreme pH or temperature variations. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, this compound's unique structure positions it as a candidate for further research in medicinal chemistry and related fields.

Formula: C₂₀H₃₀N₂O₃

InChI: InChI=1S/C20H30N2O3/c1-3-25-20(24)7-5-4-6-19(23)18-10-8-17(9-11-18)16-22-14-12-21(2)13-15-22/h8-11H,3-7,12-16H2,1-2H3

InChI key: InChIKey=GONDTMNYDRWQRK-UHFFFAOYSA-N

SMILES: C(C1=CC=C(C(CCCCC(OCC)=O)=O)C=C1)N2CCN(C)CC2

Synonyms:

• Benzenehexanoic acid, 4-[(4-methyl-1-piperazinyl)methyl]-ε-oxo-, ethyl ester
• Ethyl 4-[(4-methyl-1-piperazinyl)methyl]-ε-oxobenzenehexanoate

ethyl 6-[4-(4-methylpiperazinomethyl)phenyl]-6-oxohexanoate

CAS: 898763-63-8

Formula: C₂₀H₃₀N₂O₃

Purity: 97.0%

Molecular weight: 346.471

Ref: 10-F204595