CAS 898763-66-1

Methanone, (3-chloro-5-fluorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (3-chloro-5-fluorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of chlorine and fluorine substituents on the phenyl rings contributes to its chemical reactivity and potential biological activity. The compound features a pyrrolidine moiety, which may influence its pharmacological properties, making it of interest in medicinal chemistry. Its molecular interactions can be affected by the halogen substituents, which can enhance lipophilicity and alter binding affinities in biological systems. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Additionally, its potential applications could span various fields, including pharmaceuticals and agrochemicals, depending on its biological activity and stability. Safety and handling considerations are essential due to the presence of halogens, which can pose environmental and health risks.

Formula: C₁₈H₁₅ClFNO

InChI: InChI=1/C18H15ClFNO/c19-15-9-14(10-16(20)11-15)18(22)17-6-2-1-5-13(17)12-21-7-3-4-8-21/h1-6,9-11H,7-8,12H2

InChI key: InChIKey=QGJRABGLXQLQFE-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CC=CC2)C=CC=C1)C3=CC(Cl)=CC(F)=C3

Synonyms:

• Methanone, (3-chloro-5-fluorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-
• (3-Chloro-5-fluorophenyl)[2-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone

3-chloro-5-fluoro-2'-(3-pyrrolinomethyl) benzophenone

CAS: 898763-66-1

Purity: 97.0%

Molecular weight: 315.77

Ref: 10-F205545