CAS 898763-69-4

Methanone, [4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]phenyl-

Description:

Methanone, [4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]phenyl- is an organic compound characterized by its complex structure, which includes a methanone functional group and a phenyl ring substituted with a pyrrolidine moiety. This compound features a central carbonyl group (C=O) that is bonded to a phenyl group, which is further substituted with another phenyl ring and a pyrrolidine derivative. The presence of the pyrrolidine ring suggests potential biological activity, as many compounds with similar structures are known for their pharmacological properties. The molecular structure indicates that it may exhibit properties such as lipophilicity, which can influence its solubility and interaction with biological systems. Additionally, the compound's specific stereochemistry and functional groups may contribute to its reactivity and potential applications in medicinal chemistry or material science. As with many organic compounds, its stability, reactivity, and interactions would depend on environmental conditions such as temperature and pH.

Formula: C₁₈H₁₇NO

InChI: InChI=1S/C18H17NO/c20-18(16-6-2-1-3-7-16)17-10-8-15(9-11-17)14-19-12-4-5-13-19/h1-11H,12-14H2

InChI key: InChIKey=CDAAMXSOYPAMJM-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CC=CC2)C=C1)C3=CC=CC=C3

Synonyms:

• Methanone, [4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]phenyl-

4-(3-pyrrolinomethyl)benzophenone

CAS: 898763-69-4

Purity: 97.0%

Molecular weight: 263.34

Ref: 10-F204598