CAS 898763-72-9

Methanone, (2,4-dichlorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (2,4-dichlorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique structure, which includes a methanone functional group and multiple aromatic rings. The presence of dichlorophenyl groups indicates that it has two chlorine atoms substituted on a phenyl ring, which can influence its reactivity and physical properties. The compound also features a pyrrolidine moiety, suggesting potential biological activity, as pyrrolidine derivatives are often found in pharmaceuticals. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its aromatic character. Its molecular structure may confer specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of halogen atoms can enhance lipophilicity and alter the compound's pharmacokinetic properties. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.

Formula: C₁₈H₁₅Cl₂NO

InChI: InChI=1S/C18H15Cl2NO/c19-14-7-8-16(17(20)11-14)18(22)15-6-2-1-5-13(15)12-21-9-3-4-10-21/h1-8,11H,9-10,12H2

InChI key: InChIKey=RGWOXKPCCPJDTA-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CC=CC2)C=CC=C1)C3=C(Cl)C=C(Cl)C=C3

Synonyms:

• Methanone, (2,4-dichlorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-
• (2,4-Dichlorophenyl)[2-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone

2,4-dichloro-2'-(3-pyrrolinomethyl) benzophenone

CAS: 898763-72-9

Purity: 97.0%

Molecular weight: 332.22

Ref: 10-F205548