CAS 898763-74-1

Methanone, (2,5-dichlorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (2,5-dichlorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique structure, which includes a methanone functional group and multiple aromatic rings. The presence of dichlorophenyl groups indicates that it has chlorine substituents, which can influence its reactivity and physical properties. The compound also features a pyrrolidine moiety, suggesting potential biological activity, as pyrrolidine derivatives are often found in pharmaceuticals. This compound may exhibit moderate to high lipophilicity due to its aromatic components, affecting its solubility in organic solvents. Additionally, the presence of multiple functional groups can lead to diverse interactions in biological systems, making it of interest in medicinal chemistry. Its molecular structure may also suggest potential applications in drug development or as a synthetic intermediate in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₈H₁₅Cl₂NO

InChI: InChI=1S/C18H15Cl2NO/c19-14-7-8-17(20)16(11-14)18(22)15-6-2-1-5-13(15)12-21-9-3-4-10-21/h1-8,11H,9-10,12H2

InChI key: InChIKey=MGBKIOYEKRJTTD-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(Cl)C=CC(Cl)=C2)C=CC=C1)N3CC=CC3

Synonyms:

• (2,5-Dichlorophenyl)[2-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (2,5-dichlorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

2,5-dichloro-2'-(3-pyrrolinomethyl) benzophenone

CAS: 898763-74-1

Purity: 97.0%

Molecular weight: 332.22

Ref: 10-F205549