CAS 898763-82-1

Methanone, (3,4-difluorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (3,4-difluorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of difluorophenyl groups indicates that the compound has fluorine substituents, which can significantly influence its chemical reactivity and physical properties, such as polarity and solubility. The pyrrolidine moiety suggests potential for biological activity, as many compounds containing nitrogen heterocycles exhibit pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Additionally, the compound's stability, reactivity, and potential applications would be evaluated through various chemical assays and biological testing. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest for further research in both synthetic and medicinal chemistry.

Formula: C₁₈H₁₅F₂NO

InChI: InChI=1S/C18H15F2NO/c19-16-8-7-13(11-17(16)20)18(22)15-6-2-1-5-14(15)12-21-9-3-4-10-21/h1-8,11H,9-10,12H2

InChI key: InChIKey=LODAUDHCEHZJEX-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(F)=C(F)C=C2)C=CC=C1)N3CC=CC3

Synonyms:

• (3,4-Difluorophenyl)[2-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (3,4-difluorophenyl)[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

3,4-difluoro-2′-(3-pyrrolinomethyl) benzophenone

CAS: 898763-82-1

Formula: C₁₈H₁₅F₂NO

Purity: 97.0%

Molecular weight: 299.321

Ref: 10-F205553