CAS 898763-83-2

2-[4-(2,5-dihydropyrrol-1-ylmethyl)benzoyl]benzonitrile

Description:

2-[4-(2,5-dihydropyrrol-1-ylmethyl)benzoyl]benzonitrile, with the CAS number 898763-83-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzoyl group and a benzonitrile moiety. This compound features a dihydropyrrole ring, contributing to its potential biological activity and interactions. The presence of the nitrile functional group indicates that it may exhibit polar characteristics, influencing its solubility and reactivity. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components. Its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods such as NMR and mass spectrometry for confirmation of structure. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be essential for understanding its behavior in various chemical environments and potential applications in drug development or material science.

Formula: C₁₉H₁₆N₂O

InChI: InChI=1/C19H16N2O/c20-13-17-5-1-2-6-18(17)19(22)16-9-7-15(8-10-16)14-21-11-3-4-12-21/h1-10H,11-12,14H2

InChI key: InChIKey=WQWLJXVVZBRZEW-UHFFFAOYSA-N

SMILES: c1ccc(c(c1)C#N)C(=O)c1ccc(cc1)CN1CC=CC1

2-cyano-4'-(3-pyrrolinomethyl) benzophenone

CAS: 898763-83-2

Purity: 97.0%

Molecular weight: 288.35

Ref: 10-F204605