CAS 898763-89-8

ethyl 2-[4-(2,5-dihydropyrrol-1-ylmethyl)benzoyl]benzoate

Description:

Ethyl 2-[4-(2,5-dihydropyrrol-1-ylmethyl)benzoyl]benzoate, identified by its CAS number 898763-89-8, is an organic compound characterized by its complex structure, which includes an ethyl ester group and a benzoyl moiety linked to a 2,5-dihydropyrrole derivative. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in pharmaceuticals and organic synthesis. The presence of the dihydropyrrole ring suggests it may possess interesting biological activities, possibly related to its ability to interact with various biological targets. Additionally, the ethyl ester functionality can influence its solubility and reactivity, making it suitable for various chemical reactions. The compound's stability, reactivity, and potential for forming hydrogen bonds are also important characteristics that can affect its behavior in different environments. Overall, this compound represents a unique combination of structural features that may be explored for diverse applications in medicinal chemistry and material science.

Formula: C₂₁H₂₁NO₃

InChI: InChI=1/C21H21NO3/c1-2-25-21(24)19-8-4-3-7-18(19)20(23)17-11-9-16(10-12-17)15-22-13-5-6-14-22/h3-12H,2,13-15H2,1H3

SMILES: CCOC(=O)c1ccccc1C(=O)c1ccc(cc1)CN1CC=CC1

2-carboethoxy-4'-(3-pyrrolinomethyl) benzophenone

CAS: 898763-89-8

Purity: 97.0%

Molecular weight: 335.403

Ref: 10-F204608