CAS 898763-90-1

Cyclobutyl[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone

Description:

Cyclobutyl[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone, with the CAS number 898763-90-1, is a synthetic organic compound characterized by its unique structural features. It contains a cyclobutyl group, which is a four-membered carbon ring, contributing to its rigidity and potential strain effects. The compound also features a phenyl group, which is a benzene ring attached to a carbon atom, enhancing its aromatic properties. The presence of a pyrrolidine moiety indicates that it has nitrogen-containing heterocyclic characteristics, which can influence its reactivity and biological activity. This compound may exhibit interesting pharmacological properties due to its structural complexity, making it a candidate for research in medicinal chemistry. Its molecular interactions could be significant in drug design, particularly in targeting specific biological pathways. As with many organic compounds, its solubility, stability, and reactivity will depend on the surrounding conditions, including solvent type and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₆H₁₉NO

InChI: InChI=1S/C16H19NO/c18-16(13-7-5-8-13)15-9-2-1-6-14(15)12-17-10-3-4-11-17/h1-4,6,9,13H,5,7-8,10-12H2

InChI key: InChIKey=SRARODDSVKWTHE-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2CCC2)C=CC=C1)N3CC=CC3

Synonyms:

• Cyclobutyl[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone
• Methanone, cyclobutyl[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Cyclobutyl 2-(3-pyrrolinomethyl)phenyl ketone

CAS: 898763-90-1

Purity: 97.0%

Molecular weight: 241.334

Ref: 10-F205557