CAS 898763-92-3

Cyclopentyl[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone

Description:

Cyclopentyl[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone, with the CAS number 898763-92-3, is a chemical compound characterized by its complex structure, which includes a cyclopentyl group, a phenyl ring, and a pyrrolidine moiety. This compound typically exhibits properties associated with organic molecules, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The presence of the pyrrolidine ring suggests that it may participate in various chemical reactions, including nucleophilic substitutions or cyclization processes. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure indicates potential for interactions with biological targets, which could lead to pharmacological effects. As with many organic compounds, the specific characteristics such as melting point, boiling point, and spectral properties would need to be determined experimentally or sourced from reliable databases for precise applications in research or industry.

Formula: C₁₇H₂₁NO

InChI: InChI=1S/C17H21NO/c19-17(14-7-1-2-8-14)16-10-4-3-9-15(16)13-18-11-5-6-12-18/h3-6,9-10,14H,1-2,7-8,11-13H2

InChI key: InChIKey=FSHJBSLUAUMSJF-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2CCCC2)C=CC=C1)N3CC=CC3

Synonyms:

• Methanone, cyclopentyl[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-
• Cyclopentyl[2-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone

Cyclopentyl 2-(3-pyrrolinomethyl)phenyl ketone

CAS: 898763-92-3

Purity: 97.0%

Molecular weight: 255.361

Ref: 10-F205558