CAS 898764-01-7

Methanone, (4-bromophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (4-bromophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a bromine atom on one of the phenyl groups contributes to its reactivity and potential applications in medicinal chemistry. The compound features a pyrrolidine moiety, indicating it may exhibit interesting biological properties, possibly related to its interaction with biological targets. Its molecular structure suggests it may participate in various chemical reactions, including electrophilic substitutions due to the electron-withdrawing nature of the bromine atom. The compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic rings and the pyrrolidine group. Overall, this compound may be of interest in the development of pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₈H₁₆BrNO

InChI: InChI=1/C18H16BrNO/c19-17-9-7-16(8-10-17)18(21)15-5-3-14(4-6-15)13-20-11-1-2-12-20/h1-10H,11-13H2

InChI key: InChIKey=VKSMKZQZZQMPJI-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CC=CC2)C=C1)C3=CC=C(Br)C=C3

Synonyms:

• (4-Bromophenyl)[4-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (4-bromophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

4-bromo-4'-(3-pyrrolinomethyl) benzophenone

CAS: 898764-01-7

Purity: 97.0%

Molecular weight: 342.236

Ref: 10-F204614