CAS 898764-03-9

Methanone, (3-chlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (3-chlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chlorophenyl group indicates that it has a chlorine atom substituted on a phenyl ring, which can influence its reactivity and physical properties. The compound also features a pyrrolidine moiety, suggesting potential biological activity, as pyrrolidine derivatives are often associated with various pharmacological effects. This compound may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets due to its structural features. Its molecular interactions could be influenced by the electron-withdrawing nature of the chlorine substituent and the steric effects of the bulky phenyl groups. Overall, the characteristics of this compound make it of interest in medicinal chemistry and material science, although specific data on its reactivity, stability, and biological activity would require further investigation.

Formula: C₁₈H₁₆ClNO

InChI: InChI=1S/C18H16ClNO/c19-17-5-3-4-16(12-17)18(21)15-8-6-14(7-9-15)13-20-10-1-2-11-20/h1-9,12H,10-11,13H2

InChI key: InChIKey=LOVNXPOTAFTIQM-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC=C1)C2=CC=C(CN3CC=CC3)C=C2

Synonyms:

• (3-Chlorophenyl)[4-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (3-chlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

3-chloro-4'-(3-pyrrolinomethyl) benzophenone

CAS: 898764-03-9

Purity: 97.0%

Molecular weight: 297.78

Ref: 10-F204615