CAS 898764-05-1

Methanone, (4-chlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (4-chlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a 4-chlorophenyl group indicates that it has a chlorine substituent on one of the phenyl rings, which can influence its reactivity and physical properties. The compound also features a pyrrolidine moiety, suggesting potential biological activity, as pyrrolidine derivatives are often found in pharmaceuticals. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic nature, while its polar functional groups may enhance solubility in polar solvents. The molecular structure implies potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of multiple functional groups may lead to diverse reactivity patterns, including potential electrophilic or nucleophilic behavior. Overall, this compound's unique characteristics make it a subject of interest for further research in various chemical and biological applications.

Formula: C₁₈H₁₆ClNO

InChI: InChI=1S/C18H16ClNO/c19-17-9-7-16(8-10-17)18(21)15-5-3-14(4-6-15)13-20-11-1-2-12-20/h1-10H,11-13H2

InChI key: InChIKey=DQRJXPQNVVNJHP-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CC=CC2)C=C1)C3=CC=C(Cl)C=C3

Synonyms:

• Methanone, (4-chlorophenyl)[4-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-
• (4-Chlorophenyl)[4-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone

4-chloro-4'-(3-pyrrolinomethyl) benzophenone

CAS: 898764-05-1

Purity: 97.0%

Molecular weight: 297.78

Ref: 10-F204616